C11H26N2O — CID 61447800
N'-ethyl-N'-(2-methoxyethyl)hexane-1,6-diamine (PubChem CID 61447800) has the molecular formula C11H26N2O and a molecular weight of 202.34 g/mol. Its IUPAC name is N'-ethyl-N'-(2-methoxyethyl)hexane-1,6-diamine.
| Compound Name | N'-ethyl-N'-(2-methoxyethyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 61447800 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | N'-ethyl-N'-(2-methoxyethyl)hexane-1,6-diamine |
| SMILES | CCN(CCCCCCN)CCOC |
| InChI | InChI=1S/C11H26N2O/c1-3-13(10-11-14-2)9-7-5-4-6-8-12/h3-12H2,1-2H3 |
| InChIKey | GEXSUMXVNAXHBM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|