C10H24N2O2 — CID 55220253
N'-(2-ethoxyethyl)-N'-(2-methoxyethyl)propane-1,3-diamine (PubChem CID 55220253) has the molecular formula C10H24N2O2 and a molecular weight of 204.31 g/mol. Its IUPAC name is N'-(2-ethoxyethyl)-N'-(2-methoxyethyl)propane-1,3-diamine.
| Compound Name | N'-(2-ethoxyethyl)-N'-(2-methoxyethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 55220253 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.18 |
| IUPAC Name | N'-(2-ethoxyethyl)-N'-(2-methoxyethyl)propane-1,3-diamine |
| SMILES | CCOCCN(CCCN)CCOC |
| InChI | InChI=1S/C10H24N2O2/c1-3-14-10-8-12(6-4-5-11)7-9-13-2/h3-11H2,1-2H3 |
| InChIKey | KJEHMZHUNRCQAL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|