C10H24N2O — CID 43457099
N'-(2-ethoxyethyl)-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 43457099) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is N'-(2-ethoxyethyl)-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N'-(2-ethoxyethyl)-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43457099 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | N'-(2-ethoxyethyl)-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | CCOCCN(CCCN)C(C)C |
| InChI | InChI=1S/C10H24N2O/c1-4-13-9-8-12(10(2)3)7-5-6-11/h10H,4-9,11H2,1-3H3 |
| InChIKey | RTSASLBGPXURPH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|