About N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine
N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 43137377) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine.
Analyze N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine?
The IUPAC name of N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine (CID 43137377) is N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine.
What is the SMILES notation for N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine?
The canonical SMILES for N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine is COCCN(CCCN)C(C)C.
What is the InChIKey of N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine?
The InChIKey is FFGFPYBSEOKXGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O/c1-9(2)11(6-4-5-10)7-8-12-3/h9H,4-8,10H2,1-3H3.
What are the key properties of N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine?
N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine has a molecular weight of 174.29 g/mol, XLogP of 0.69, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methoxyethyl)-N'-propan-2-ylpropane-1,3-diamine is sourced from PubChem (CID 43137377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).