C11H26N2O — CID 104682346
N-(2-ethoxyethyl)-N,2-dimethylpentane-1,5-diamine (PubChem CID 104682346) has the molecular formula C11H26N2O and a molecular weight of 202.34 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N,2-dimethylpentane-1,5-diamine.
| Compound Name | N-(2-ethoxyethyl)-N,2-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 104682346 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | N-(2-ethoxyethyl)-N,2-dimethylpentane-1,5-diamine |
| SMILES | CCOCCN(C)CC(C)CCCN |
| InChI | InChI=1S/C11H26N2O/c1-4-14-9-8-13(3)10-11(2)6-5-7-12/h11H,4-10,12H2,1-3H3 |
| InChIKey | ONESGNNCEMYNHN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|