C18H39NO2 — CID 170062056
N,2-dimethyl-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]pentan-1-amine (PubChem CID 170062056) has the molecular formula C18H39NO2 and a molecular weight of 301.51 g/mol. Its IUPAC name is N,2-dimethyl-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]pentan-1-amine.
| Compound Name | N,2-dimethyl-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 170062056 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.51 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | N,2-dimethyl-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]pentan-1-amine |
| SMILES | CCCC(C)CN(C)CCOCCOCCCC(C)CC |
| InChI | InChI=1S/C18H39NO2/c1-6-9-18(4)16-19(5)11-13-21-15-14-20-12-8-10-17(3)7-2/h17-18H,6-16H2,1-5H3 |
| InChIKey | JCAHWUIOIJDOEY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|