C10H23NO2 — CID 61070692
2-[2-[methyl(2-methylbutyl)amino]ethoxy]ethanol (PubChem CID 61070692) has the molecular formula C10H23NO2 and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-[2-[methyl(2-methylbutyl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[methyl(2-methylbutyl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 61070692 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 2-[2-[methyl(2-methylbutyl)amino]ethoxy]ethanol |
| SMILES | CCC(C)CN(C)CCOCCO |
| InChI | InChI=1S/C10H23NO2/c1-4-10(2)9-11(3)5-7-13-8-6-12/h10,12H,4-9H2,1-3H3 |
| InChIKey | VEGCTOVARLWVOD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|