C9H20BrN — CID 61288758
N-(3-bromopropyl)-N,2-dimethylbutan-1-amine (PubChem CID 61288758) has the molecular formula C9H20BrN and a molecular weight of 222.17 g/mol. Its IUPAC name is N-(3-bromopropyl)-N,2-dimethylbutan-1-amine.
| Compound Name | N-(3-bromopropyl)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 61288758 |
| Molecular Formula | C9H20BrN |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | N-(3-bromopropyl)-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)CN(C)CCCBr |
| InChI | InChI=1S/C9H20BrN/c1-4-9(2)8-11(3)7-5-6-10/h9H,4-8H2,1-3H3 |
| InChIKey | BBBJLCOJXKQNPW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|