C8H19N — CID 89086806
(2S)-N-ethyl-N,2-dimethylbutan-1-amine (PubChem CID 89086806) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is (2S)-N-ethyl-N,2-dimethylbutan-1-amine.
| Compound Name | (2S)-N-ethyl-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 89086806 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | (2S)-N-ethyl-N,2-dimethylbutan-1-amine |
| SMILES | CC[C@H](C)CN(C)CC |
| InChI | InChI=1S/C8H19N/c1-5-8(3)7-9(4)6-2/h8H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | FDVGAMJGVBLLES-QMMMGPOBSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |