C9H19N — CID 139352372
N-ethyl-N,2-dimethylpent-4-en-1-amine (PubChem CID 139352372) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is N-ethyl-N,2-dimethylpent-4-en-1-amine.
| Compound Name | N-ethyl-N,2-dimethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 139352372 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | N-ethyl-N,2-dimethylpent-4-en-1-amine |
| SMILES | C=CCC(C)CN(C)CC |
| InChI | InChI=1S/C9H19N/c1-5-7-9(3)8-10(4)6-2/h5,9H,1,6-8H2,2-4H3 |
| InChIKey | AIFPLOPFNCJGED-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|