About sodium;hydride;4-methylhex-1-ene
sodium;hydride;4-methylhex-1-ene (PubChem CID 173048656) has the molecular formula C7H15Na
and a molecular weight of 122.19 g/mol. Its IUPAC name is sodium;hydride;4-methylhex-1-ene.
Molecular Properties
| Compound Name | sodium;hydride;4-methylhex-1-ene |
| PubChem CID | 173048656 |
| Molecular Formula | C7H15Na |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | sodium;hydride;4-methylhex-1-ene |
| SMILES | C=CCC(C)CC.[H-].[Na+] |
| InChI | InChI=1S/C7H14.Na.H/c1-4-6-7(3)5-2;;/h4,7H,1,5-6H2,2-3H3;;/q;+1;-1 |
| InChIKey | RWQTTXXWXQZNQS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;4-methylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-methylhex-1-ene?
The IUPAC name of sodium;hydride;4-methylhex-1-ene (CID 173048656) is sodium;hydride;4-methylhex-1-ene.
What is the SMILES notation for sodium;hydride;4-methylhex-1-ene?
The canonical SMILES for sodium;hydride;4-methylhex-1-ene is C=CCC(C)CC.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-methylhex-1-ene?
The InChIKey is RWQTTXXWXQZNQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.Na.H/c1-4-6-7(3)5-2;;/h4,7H,1,5-6H2,2-3H3;;/q;+1;-1.
What are the key properties of sodium;hydride;4-methylhex-1-ene?
sodium;hydride;4-methylhex-1-ene has a molecular weight of 122.19 g/mol, XLogP of -0.27, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-methylhex-1-ene is sourced from PubChem (CID 173048656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).