About methanol;(2S)-2-methylpent-4-en-1-ol
methanol;(2S)-2-methylpent-4-en-1-ol (PubChem CID 143099829) has the molecular formula C7H16O2
and a molecular weight of 132.20 g/mol. Its IUPAC name is methanol;(2S)-2-methylpent-4-en-1-ol.
Molecular Properties
| Compound Name | methanol;(2S)-2-methylpent-4-en-1-ol |
| PubChem CID | 143099829 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | methanol;(2S)-2-methylpent-4-en-1-ol |
| SMILES | C=CC[C@H](C)CO.CO |
| InChI | InChI=1S/C6H12O.CH4O/c1-3-4-6(2)5-7;1-2/h3,6-7H,1,4-5H2,2H3;2H,1H3/t6-;/m0./s1 |
| InChIKey | FIQIJHGWQOGVAA-RGMNGODLSA-N |
| XLogP | 0.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methanol;(2S)-2-methylpent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;(2S)-2-methylpent-4-en-1-ol?
The IUPAC name of methanol;(2S)-2-methylpent-4-en-1-ol (CID 143099829) is methanol;(2S)-2-methylpent-4-en-1-ol.
What is the SMILES notation for methanol;(2S)-2-methylpent-4-en-1-ol?
The canonical SMILES for methanol;(2S)-2-methylpent-4-en-1-ol is C=CC[C@H](C)CO.CO.
What is the InChIKey of methanol;(2S)-2-methylpent-4-en-1-ol?
The InChIKey is FIQIJHGWQOGVAA-RGMNGODLSA-N. The full InChI is InChI=1S/C6H12O.CH4O/c1-3-4-6(2)5-7;1-2/h3,6-7H,1,4-5H2,2H3;2H,1H3/t6-;/m0./s1.
What are the key properties of methanol;(2S)-2-methylpent-4-en-1-ol?
methanol;(2S)-2-methylpent-4-en-1-ol has a molecular weight of 132.20 g/mol, XLogP of 0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;(2S)-2-methylpent-4-en-1-ol is sourced from PubChem (CID 143099829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).