C8H16N2 — CID 88988242
4-methylhepta-1,6-diene-1,1-diamine (PubChem CID 88988242) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-methylhepta-1,6-diene-1,1-diamine.
| Compound Name | 4-methylhepta-1,6-diene-1,1-diamine |
|---|---|
| PubChem CID | 88988242 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 4-methylhepta-1,6-diene-1,1-diamine |
| SMILES | C=CCC(C)CC=C(N)N |
| InChI | InChI=1S/C8H16N2/c1-3-4-7(2)5-6-8(9)10/h3,6-7H,1,4-5,9-10H2,2H3 |
| InChIKey | XDPOKXWYKHIHEE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|