About pent-4-en-2-ol;urea
pent-4-en-2-ol;urea (PubChem CID 88650571) has the molecular formula C6H14N2O2
and a molecular weight of 146.19 g/mol. Its IUPAC name is pent-4-en-2-ol;urea.
Molecular Properties
| Compound Name | pent-4-en-2-ol;urea |
| PubChem CID | 88650571 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | pent-4-en-2-ol;urea |
| SMILES | C=CCC(C)O.NC(N)=O |
| InChI | InChI=1S/C5H10O.CH4N2O/c1-3-4-5(2)6;2-1(3)4/h3,5-6H,1,4H2,2H3;(H4,2,3,4) |
| InChIKey | WAFYHIZSNJEMBG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-4-en-2-ol;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-en-2-ol;urea?
The IUPAC name of pent-4-en-2-ol;urea (CID 88650571) is pent-4-en-2-ol;urea.
What is the SMILES notation for pent-4-en-2-ol;urea?
The canonical SMILES for pent-4-en-2-ol;urea is C=CCC(C)O.NC(N)=O.
What is the InChIKey of pent-4-en-2-ol;urea?
The InChIKey is WAFYHIZSNJEMBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.CH4N2O/c1-3-4-5(2)6;2-1(3)4/h3,5-6H,1,4H2,2H3;(H4,2,3,4).
What are the key properties of pent-4-en-2-ol;urea?
pent-4-en-2-ol;urea has a molecular weight of 146.19 g/mol, XLogP of -0.03, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-en-2-ol;urea is sourced from PubChem (CID 88650571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).