C6H13NO — CID 130715143
(2S,3R)-3-aminohex-5-en-2-ol (PubChem CID 130715143) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is (2S,3R)-3-aminohex-5-en-2-ol.
| Compound Name | (2S,3R)-3-aminohex-5-en-2-ol |
|---|---|
| PubChem CID | 130715143 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | (2S,3R)-3-aminohex-5-en-2-ol |
| SMILES | C=CC[C@@H](N)[C@H](C)O |
| InChI | InChI=1S/C6H13NO/c1-3-4-6(7)5(2)8/h3,5-6,8H,1,4,7H2,2H3/t5-,6+/m0/s1 |
| InChIKey | BJORUWKNBLQGBX-NTSWFWBYSA-N |
| XLogP | 0.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|