C9H19N — CID 131966570
3,4-dimethylhept-6-en-2-amine (PubChem CID 131966570) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 3,4-dimethylhept-6-en-2-amine.
| Compound Name | 3,4-dimethylhept-6-en-2-amine |
|---|---|
| PubChem CID | 131966570 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 3,4-dimethylhept-6-en-2-amine |
| SMILES | C=CCC(C)C(C)C(C)N |
| InChI | InChI=1S/C9H19N/c1-5-6-7(2)8(3)9(4)10/h5,7-9H,1,6,10H2,2-4H3 |
| InChIKey | HXEGLVXSWSFZKN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|