C7H13NO2 — CID 10866451
(2S)-2-[(1S)-1-aminoethyl]pent-4-enoic acid (PubChem CID 10866451) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (2S)-2-[(1S)-1-aminoethyl]pent-4-enoic acid.
| Compound Name | (2S)-2-[(1S)-1-aminoethyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 10866451 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2S)-2-[(1S)-1-aminoethyl]pent-4-enoic acid |
| SMILES | C=CCC(C(=O)O)[C@H](C)N |
| InChI | InChI=1S/C7H13NO2/c1-3-4-6(5(2)8)7(9)10/h3,5-6H,1,4,8H2,2H3,(H,9,10)/t5-,6?/m0/s1 |
| InChIKey | CXTZTZNNNYMNMA-ZBHICJROSA-N |
| XLogP | 0.61 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|