C14H27NO3 — CID 161452637
(2S)-2-aminopent-4-enoic acid;ethane;(3S)-3-methylhex-5-en-2-one (PubChem CID 161452637) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is (2S)-2-aminopent-4-enoic acid;ethane;(3S)-3-methylhex-5-en-2-one.
| Compound Name | (2S)-2-aminopent-4-enoic acid;ethane;(3S)-3-methylhex-5-en-2-one |
|---|---|
| PubChem CID | 161452637 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (2S)-2-aminopent-4-enoic acid;ethane;(3S)-3-methylhex-5-en-2-one |
| SMILES | C=CC[C@H](C)C(C)=O.C=CC[C@H](N)C(=O)O.CC |
| InChI | InChI=1S/C7H12O.C5H9NO2.C2H6/c1-4-5-6(2)7(3)8;1-2-3-4(6)5(7)8;1-2/h4,6H,1,5H2,2-3H3;2,4H,1,3,6H2,(H,7,8);1-2H3/t6-;4-;/m00./s1 |
| InChIKey | WASSNEPCBPRWBW-JQFBFHSRSA-N |
| XLogP | 2.79 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|