C8H15N — CID 143795621
(5Z)-5-methylhepta-1,5-dien-4-amine (PubChem CID 143795621) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (5Z)-5-methylhepta-1,5-dien-4-amine.
| Compound Name | (5Z)-5-methylhepta-1,5-dien-4-amine |
|---|---|
| PubChem CID | 143795621 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (5Z)-5-methylhepta-1,5-dien-4-amine |
| SMILES | C=CCC(N)/C(C)=C\C |
| InChI | InChI=1S/C8H15N/c1-4-6-8(9)7(3)5-2/h4-5,8H,1,6,9H2,2-3H3/b7-5- |
| InChIKey | BMIIZOOWWLDIFK-ALCCZGGFSA-N |
| XLogP | 1.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|