C13H21NO — CID 89154086
(5Z)-8-[(1Z)-buta-1,3-dienoxy]-5-methylocta-1,5-dien-4-amine (PubChem CID 89154086) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (5Z)-8-[(1Z)-buta-1,3-dienoxy]-5-methylocta-1,5-dien-4-amine.
| Compound Name | (5Z)-8-[(1Z)-buta-1,3-dienoxy]-5-methylocta-1,5-dien-4-amine |
|---|---|
| PubChem CID | 89154086 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (5Z)-8-[(1Z)-buta-1,3-dienoxy]-5-methylocta-1,5-dien-4-amine |
| SMILES | C=C/C=C\OCC/C=C(/C)C(N)CC=C |
| InChI | InChI=1S/C13H21NO/c1-4-6-10-15-11-7-9-12(3)13(14)8-5-2/h4-6,9-10,13H,1-2,7-8,11,14H2,3H3/b10-6-,12-9- |
| InChIKey | WBDALNQCAOQLEC-LQBUGXQISA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|