C8H13NO — CID 116606914
4-amino-2-methylhepta-1,6-dien-3-one (PubChem CID 116606914) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-amino-2-methylhepta-1,6-dien-3-one.
| Compound Name | 4-amino-2-methylhepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 116606914 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4-amino-2-methylhepta-1,6-dien-3-one |
| SMILES | C=CCC(N)C(=O)C(=C)C |
| InChI | InChI=1S/C8H13NO/c1-4-5-7(9)8(10)6(2)3/h4,7H,1-2,5,9H2,3H3 |
| InChIKey | MKFLIKMMUYZDMC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|