C11H22N2O2 — CID 106188129
2-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pent-4-enamide (PubChem CID 106188129) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pent-4-enamide.
| Compound Name | 2-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pent-4-enamide |
|---|---|
| PubChem CID | 106188129 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pent-4-enamide |
| SMILES | C=CCC(N)C(=O)NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C11H22N2O2/c1-6-7-8(12)9(14)13-10(2,3)11(4,5)15/h6,8,15H,1,7,12H2,2-5H3,(H,13,14) |
| InChIKey | MFPMUBRIOBRSTK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|