About 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide
2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide (PubChem CID 106176820) has the molecular formula C8H14F2N2O2
and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide |
| PubChem CID | 106176820 |
| Molecular Formula | C8H14F2N2O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide |
| SMILES | C=CCC(N)C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C8H14F2N2O2/c1-2-3-6(11)7(14)12-4-8(9,10)5-13/h2,6,13H,1,3-5,11H2,(H,12,14) |
| InChIKey | QXVQVPWTFMTLKA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide?
The IUPAC name of 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide (CID 106176820) is 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide.
What is the SMILES notation for 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide?
The canonical SMILES for 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide is C=CCC(N)C(=O)NCC(F)(F)CO.
What is the InChIKey of 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide?
The InChIKey is QXVQVPWTFMTLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O2/c1-2-3-6(11)7(14)12-4-8(9,10)5-13/h2,6,13H,1,3-5,11H2,(H,12,14).
What are the key properties of 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide?
2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide has a molecular weight of 208.21 g/mol, XLogP of -0.37, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,2-difluoro-3-hydroxypropyl)pent-4-enamide is sourced from PubChem (CID 106176820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).