C9H18F2N2O2 — CID 106176696
2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylpentanamide (PubChem CID 106176696) has the molecular formula C9H18F2N2O2 and a molecular weight of 224.25 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylpentanamide.
| Compound Name | 2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 106176696 |
| Molecular Formula | C9H18F2N2O2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C9H18F2N2O2/c1-6(2)3-7(12)8(15)13-4-9(10,11)5-14/h6-7,14H,3-5,12H2,1-2H3,(H,13,15) |
| InChIKey | HLXKUNMPDWYWMI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |