C13H28N2O2 — CID 104903660
(2R)-2-amino-N-(2-hydroxy-2,4-dimethylpentyl)-4-methylpentanamide (PubChem CID 104903660) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-hydroxy-2,4-dimethylpentyl)-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-(2-hydroxy-2,4-dimethylpentyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 104903660 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | (2R)-2-amino-N-(2-hydroxy-2,4-dimethylpentyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)NCC(C)(O)CC(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-9(2)6-11(14)12(16)15-8-13(5,17)7-10(3)4/h9-11,17H,6-8,14H2,1-5H3,(H,15,16)/t11-,13?/m1/s1 |
| InChIKey | SAUXJECWKKCCSN-JTDNENJMSA-N |
| XLogP | 1.27 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |