C12H26N2O2 — CID 106292244
(2R)-2-amino-N-(2-hydroxy-2-methylpentyl)-4-methylpentanamide (PubChem CID 106292244) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-hydroxy-2-methylpentyl)-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-(2-hydroxy-2-methylpentyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 106292244 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | (2R)-2-amino-N-(2-hydroxy-2-methylpentyl)-4-methylpentanamide |
| SMILES | CCCC(C)(O)CNC(=O)[C@H](N)CC(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-5-6-12(4,16)8-14-11(15)10(13)7-9(2)3/h9-10,16H,5-8,13H2,1-4H3,(H,14,15)/t10-,12?/m1/s1 |
| InChIKey | FEQWPYAUHYVNLO-RWANSRKNSA-N |
| XLogP | 1.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |