C11H21NO4 — CID 114898712
3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methyl-3-oxopropanoic acid (PubChem CID 114898712) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114898712 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C)CC(C)(O)CNC(=O)C(C)C(=O)O |
| InChI | InChI=1S/C11H21NO4/c1-7(2)5-11(4,16)6-12-9(13)8(3)10(14)15/h7-8,16H,5-6H2,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | LENGWMIQRAVCGT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|