C15H31NO2 — CID 82986949
N-(2-hydroxy-2,4-dimethylpentyl)-2-propylpentanamide (PubChem CID 82986949) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is N-(2-hydroxy-2,4-dimethylpentyl)-2-propylpentanamide.
| Compound Name | N-(2-hydroxy-2,4-dimethylpentyl)-2-propylpentanamide |
|---|---|
| PubChem CID | 82986949 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | N-(2-hydroxy-2,4-dimethylpentyl)-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)NCC(C)(O)CC(C)C |
| InChI | InChI=1S/C15H31NO2/c1-6-8-13(9-7-2)14(17)16-11-15(5,18)10-12(3)4/h12-13,18H,6-11H2,1-5H3,(H,16,17) |
| InChIKey | GOYWXVJDAZFEIW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |