C12H25NO2 — CID 66180259
N-(2-hydroxy-2,4-dimethylpentyl)-2,2-dimethylpropanamide (PubChem CID 66180259) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(2-hydroxy-2,4-dimethylpentyl)-2,2-dimethylpropanamide.
| Compound Name | N-(2-hydroxy-2,4-dimethylpentyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 66180259 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | N-(2-hydroxy-2,4-dimethylpentyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)CC(C)(O)CNC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H25NO2/c1-9(2)7-12(6,15)8-13-10(14)11(3,4)5/h9,15H,7-8H2,1-6H3,(H,13,14) |
| InChIKey | PICFLGBCKLMJAC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |