C16H31NO2 — CID 114458366
2-cycloheptyl-N-(2-hydroxy-2,4-dimethylpentyl)acetamide (PubChem CID 114458366) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 2-cycloheptyl-N-(2-hydroxy-2,4-dimethylpentyl)acetamide.
| Compound Name | 2-cycloheptyl-N-(2-hydroxy-2,4-dimethylpentyl)acetamide |
|---|---|
| PubChem CID | 114458366 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 2-cycloheptyl-N-(2-hydroxy-2,4-dimethylpentyl)acetamide |
| SMILES | CC(C)CC(C)(O)CNC(=O)CC1CCCCCC1 |
| InChI | InChI=1S/C16H31NO2/c1-13(2)11-16(3,19)12-17-15(18)10-14-8-6-4-5-7-9-14/h13-14,19H,4-12H2,1-3H3,(H,17,18) |
| InChIKey | KNLNDNGRRYKXGG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |