2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid

C9H19NO3 — CID 66178823

IUPAC2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid
SMILESCC(C)CC(C)(O)CNCC(=O)O
InChIInChI=1S/C9H19NO3/c1-7(2)4-9(3,13)6-10-5-8(11)12/h7,10,13H,4-6H2,1-3H3,(H,11,12)
InChIKeyIURUIZYSNGWNHQ-UHFFFAOYSA-N
MW189.25 g/mol
LogP0.46
Rot. Bonds6

About 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid

2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid (PubChem CID 66178823) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid
PubChem CID66178823
Molecular FormulaC9H19NO3
Molecular Weight189.25 g/mol
Exact Mass189.14
IUPAC Name2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid
SMILESCC(C)CC(C)(O)CNCC(=O)O
InChIInChI=1S/C9H19NO3/c1-7(2)4-9(3,13)6-10-5-8(11)12/h7,10,13H,4-6H2,1-3H3,(H,11,12)
InChIKeyIURUIZYSNGWNHQ-UHFFFAOYSA-N
XLogP0.46
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.25
LogP ≤ 50.46
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid?
The IUPAC name of 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid (CID 66178823) is 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid.
What is the SMILES notation for 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid?
The canonical SMILES for 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid is CC(C)CC(C)(O)CNCC(=O)O.
What is the InChIKey of 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid?
The InChIKey is IURUIZYSNGWNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-7(2)4-9(3,13)6-10-5-8(11)12/h7,10,13H,4-6H2,1-3H3,(H,11,12).
What are the key properties of 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid?
2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid has a molecular weight of 189.25 g/mol, XLogP of 0.46, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-hydroxy-2,4-dimethylpentyl)amino]acetic acid is sourced from PubChem (CID 66178823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).