About 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid
3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid (PubChem CID 79397406) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid.
Analyze 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid?
The IUPAC name of 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid (CID 79397406) is 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid.
What is the SMILES notation for 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid?
The canonical SMILES for 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid is CC(C)CC(C)(O)CNC(C)C(C)C(=O)O.
What is the InChIKey of 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid?
The InChIKey is CYRAYBNSOSCSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-8(2)6-12(5,16)7-13-10(4)9(3)11(14)15/h8-10,13,16H,6-7H2,1-5H3,(H,14,15).
What are the key properties of 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid?
3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid has a molecular weight of 231.34 g/mol, XLogP of 1.48, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid is sourced from PubChem (CID 79397406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).