About 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid
3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid (PubChem CID 79397406) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid.
Molecular Properties
| Compound Name | 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid |
| PubChem CID | 79397406 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid |
| SMILES | CC(C)CC(C)(O)CNC(C)C(C)C(=O)O |
| InChI | InChI=1S/C12H25NO3/c1-8(2)6-12(5,16)7-13-10(4)9(3)11(14)15/h8-10,13,16H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | CYRAYBNSOSCSPE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid?
The IUPAC name of 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid (CID 79397406) is 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid.
What is the SMILES notation for 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid?
The canonical SMILES for 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid is CC(C)CC(C)(O)CNC(C)C(C)C(=O)O.
What is the InChIKey of 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid?
The InChIKey is CYRAYBNSOSCSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-8(2)6-12(5,16)7-13-10(4)9(3)11(14)15/h8-10,13,16H,6-7H2,1-5H3,(H,14,15).
What are the key properties of 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid?
3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid has a molecular weight of 231.34 g/mol, XLogP of 1.48, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-methylbutanoic acid is sourced from PubChem (CID 79397406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).