C8H14F2N2O4 — CID 106176979
ethyl 2-amino-3-[(2,2-difluoro-3-hydroxypropyl)amino]-3-oxopropanoate (PubChem CID 106176979) has the molecular formula C8H14F2N2O4 and a molecular weight of 240.21 g/mol. Its IUPAC name is ethyl 2-amino-3-[(2,2-difluoro-3-hydroxypropyl)amino]-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-[(2,2-difluoro-3-hydroxypropyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 106176979 |
| Molecular Formula | C8H14F2N2O4 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | ethyl 2-amino-3-[(2,2-difluoro-3-hydroxypropyl)amino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C8H14F2N2O4/c1-2-16-7(15)5(11)6(14)12-3-8(9,10)4-13/h5,13H,2-4,11H2,1H3,(H,12,14) |
| InChIKey | LCGVMSDZDMVIJX-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|