C11H23N3O4 — CID 106148353
ethyl 2-amino-3-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-3-oxopropanoate (PubChem CID 106148353) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl 2-amino-3-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 106148353 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethyl 2-amino-3-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)NCC(C)(O)CN(C)C |
| InChI | InChI=1S/C11H23N3O4/c1-5-18-10(16)8(12)9(15)13-6-11(2,17)7-14(3)4/h8,17H,5-7,12H2,1-4H3,(H,13,15) |
| InChIKey | OYVNSDDIOIDULD-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|