C13H27N3O3 — CID 103839615
2-acetamido-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-methylbutanamide (PubChem CID 103839615) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-acetamido-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-methylbutanamide.
| Compound Name | 2-acetamido-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 103839615 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-acetamido-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-methylbutanamide |
| SMILES | CC(=O)NC(C(=O)NCC(C)(O)CN(C)C)C(C)C |
| InChI | InChI=1S/C13H27N3O3/c1-9(2)11(15-10(3)17)12(18)14-7-13(4,19)8-16(5)6/h9,11,19H,7-8H2,1-6H3,(H,14,18)(H,15,17) |
| InChIKey | GEMOLZHMPYZOIN-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |