C9H22N2O2 — CID 106147817
1-(dimethylamino)-3-[[(2R)-2-hydroxypropyl]amino]-2-methylpropan-2-ol (PubChem CID 106147817) has the molecular formula C9H22N2O2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[[(2R)-2-hydroxypropyl]amino]-2-methylpropan-2-ol.
| Compound Name | 1-(dimethylamino)-3-[[(2R)-2-hydroxypropyl]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106147817 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1-(dimethylamino)-3-[[(2R)-2-hydroxypropyl]amino]-2-methylpropan-2-ol |
| SMILES | C[C@@H](O)CNCC(C)(O)CN(C)C |
| InChI | InChI=1S/C9H22N2O2/c1-8(12)5-10-6-9(2,13)7-11(3)4/h8,10,12-13H,5-7H2,1-4H3/t8-,9?/m1/s1 |
| InChIKey | KIVDVNZPVSOGHA-VEDVMXKPSA-N |
| XLogP | -0.73 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |