C13H30N2O3 — CID 114150038
1-(dimethylamino)-3-[[2-hydroxy-3-(2-methylpropoxy)propyl]amino]-2-methylpropan-2-ol (PubChem CID 114150038) has the molecular formula C13H30N2O3 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[[2-hydroxy-3-(2-methylpropoxy)propyl]amino]-2-methylpropan-2-ol.
| Compound Name | 1-(dimethylamino)-3-[[2-hydroxy-3-(2-methylpropoxy)propyl]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 114150038 |
| Molecular Formula | C13H30N2O3 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1-(dimethylamino)-3-[[2-hydroxy-3-(2-methylpropoxy)propyl]amino]-2-methylpropan-2-ol |
| SMILES | CC(C)COCC(O)CNCC(C)(O)CN(C)C |
| InChI | InChI=1S/C13H30N2O3/c1-11(2)7-18-8-12(16)6-14-9-13(3,17)10-15(4)5/h11-12,14,16-17H,6-10H2,1-5H3 |
| InChIKey | OBBMUIPHDWALSB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |