C15H25ClN2O3 — CID 106147644
1-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-3-(dimethylamino)-2-methylpropan-2-ol (PubChem CID 106147644) has the molecular formula C15H25ClN2O3 and a molecular weight of 316.83 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-3-(dimethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-3-(dimethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106147644 |
| Molecular Formula | C15H25ClN2O3 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-3-(dimethylamino)-2-methylpropan-2-ol |
| SMILES | CN(C)CC(C)(O)CNCC(O)COc1ccccc1Cl |
| InChI | InChI=1S/C15H25ClN2O3/c1-15(20,11-18(2)3)10-17-8-12(19)9-21-14-7-5-4-6-13(14)16/h4-7,12,17,19-20H,8-11H2,1-3H3 |
| InChIKey | SRLJZYBCEIPZBZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |