C15H24ClNO4 — CID 106254970
1-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 106254970) has the molecular formula C15H24ClNO4 and a molecular weight of 317.81 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 106254970 |
| Molecular Formula | C15H24ClNO4 |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNCC(O)COc1ccccc1Cl |
| InChI | InChI=1S/C15H24ClNO4/c1-15(19,7-8-20-2)11-17-9-12(18)10-21-14-6-4-3-5-13(14)16/h3-6,12,17-19H,7-11H2,1-2H3 |
| InChIKey | RGNXJYYYJAOBDF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |