C12H18ClN3O3 — CID 83121783
2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]ethylurea (PubChem CID 83121783) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]ethylurea.
| Compound Name | 2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]ethylurea |
|---|---|
| PubChem CID | 83121783 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]ethylurea |
| SMILES | NC(=O)NCCNCC(O)COc1ccccc1Cl |
| InChI | InChI=1S/C12H18ClN3O3/c13-10-3-1-2-4-11(10)19-8-9(17)7-15-5-6-16-12(14)18/h1-4,9,15,17H,5-8H2,(H3,14,16,18) |
| InChIKey | AHDJVFXFOQZBJK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|