C12H16Cl2N2O3 — CID 54938626
3-[[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]amino]propanamide (PubChem CID 54938626) has the molecular formula C12H16Cl2N2O3 and a molecular weight of 307.18 g/mol. Its IUPAC name is 3-[[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]amino]propanamide.
| Compound Name | 3-[[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]amino]propanamide |
|---|---|
| PubChem CID | 54938626 |
| Molecular Formula | C12H16Cl2N2O3 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 3-[[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]amino]propanamide |
| SMILES | NC(=O)CCNCC(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2O3/c13-8-1-2-11(10(14)5-8)19-7-9(17)6-16-4-3-12(15)18/h1-2,5,9,16-17H,3-4,6-7H2,(H2,15,18) |
| InChIKey | YKZQRTPJEGDEHP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|