C13H20Cl2N2O2 — CID 60635084
1-(2,4-dichlorophenoxy)-3-[2-(dimethylamino)ethylamino]propan-2-ol (PubChem CID 60635084) has the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 1-(2,4-dichlorophenoxy)-3-[2-(dimethylamino)ethylamino]propan-2-ol.
| Compound Name | 1-(2,4-dichlorophenoxy)-3-[2-(dimethylamino)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 60635084 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-(2,4-dichlorophenoxy)-3-[2-(dimethylamino)ethylamino]propan-2-ol |
| SMILES | CN(C)CCNCC(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H20Cl2N2O2/c1-17(2)6-5-16-8-11(18)9-19-13-4-3-10(14)7-12(13)15/h3-4,7,11,16,18H,5-6,8-9H2,1-2H3 |
| InChIKey | MHOHRIPRZRZOLR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|