C11H16Cl2N2O2 — CID 62140528
1-(2-aminoethylamino)-3-(2,4-dichlorophenoxy)propan-2-ol (PubChem CID 62140528) has the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.17 g/mol. Its IUPAC name is 1-(2-aminoethylamino)-3-(2,4-dichlorophenoxy)propan-2-ol.
| Compound Name | 1-(2-aminoethylamino)-3-(2,4-dichlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 62140528 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-(2-aminoethylamino)-3-(2,4-dichlorophenoxy)propan-2-ol |
| SMILES | NCCNCC(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H16Cl2N2O2/c12-8-1-2-11(10(13)5-8)17-7-9(16)6-15-4-3-14/h1-2,5,9,15-16H,3-4,6-7,14H2 |
| InChIKey | ZVPSCWAMFRSDJG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|