C16H16Cl2FNO2 — CID 168510550
1-(2,4-dichlorophenoxy)-3-[(4-fluorophenyl)methylamino]propan-2-ol (PubChem CID 168510550) has the molecular formula C16H16Cl2FNO2 and a molecular weight of 344.21 g/mol. Its IUPAC name is 1-(2,4-dichlorophenoxy)-3-[(4-fluorophenyl)methylamino]propan-2-ol.
| Compound Name | 1-(2,4-dichlorophenoxy)-3-[(4-fluorophenyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 168510550 |
| Molecular Formula | C16H16Cl2FNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-(2,4-dichlorophenoxy)-3-[(4-fluorophenyl)methylamino]propan-2-ol |
| SMILES | OC(CNCc1ccc(F)cc1)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2FNO2/c17-12-3-6-16(15(18)7-12)22-10-14(21)9-20-8-11-1-4-13(19)5-2-11/h1-7,14,20-21H,8-10H2 |
| InChIKey | YYGBMBKCULOTAA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |