C14H15Cl2NO2S — CID 60632969
1-(2,4-dichlorophenoxy)-3-(thiophen-2-ylmethylamino)propan-2-ol (PubChem CID 60632969) has the molecular formula C14H15Cl2NO2S and a molecular weight of 332.25 g/mol. Its IUPAC name is 1-(2,4-dichlorophenoxy)-3-(thiophen-2-ylmethylamino)propan-2-ol.
| Compound Name | 1-(2,4-dichlorophenoxy)-3-(thiophen-2-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 60632969 |
| Molecular Formula | C14H15Cl2NO2S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 1-(2,4-dichlorophenoxy)-3-(thiophen-2-ylmethylamino)propan-2-ol |
| SMILES | OC(CNCc1cccs1)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2NO2S/c15-10-3-4-14(13(16)6-10)19-9-11(18)7-17-8-12-2-1-5-20-12/h1-6,11,17-18H,7-9H2 |
| InChIKey | NIYAVVGLUPYZGA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |