C13H15Cl2N3O3 — CID 106401068
1-(2,4-dichlorophenoxy)-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propan-2-ol (PubChem CID 106401068) has the molecular formula C13H15Cl2N3O3 and a molecular weight of 332.19 g/mol. Its IUPAC name is 1-(2,4-dichlorophenoxy)-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propan-2-ol.
| Compound Name | 1-(2,4-dichlorophenoxy)-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 106401068 |
| Molecular Formula | C13H15Cl2N3O3 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-(2,4-dichlorophenoxy)-3-[2-(1,2,4-oxadiazol-3-yl)ethylamino]propan-2-ol |
| SMILES | OC(CNCCc1ncon1)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2N3O3/c14-9-1-2-12(11(15)5-9)20-7-10(19)6-16-4-3-13-17-8-21-18-13/h1-2,5,8,10,16,19H,3-4,6-7H2 |
| InChIKey | LWCKYCZJQYQDBK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|