C15H19Cl2N3O2 — CID 167880911
1-(2,4-dichlorophenoxy)-3-[2-(1-methylimidazol-4-yl)ethylamino]propan-2-ol (PubChem CID 167880911) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 1-(2,4-dichlorophenoxy)-3-[2-(1-methylimidazol-4-yl)ethylamino]propan-2-ol.
| Compound Name | 1-(2,4-dichlorophenoxy)-3-[2-(1-methylimidazol-4-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 167880911 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-(2,4-dichlorophenoxy)-3-[2-(1-methylimidazol-4-yl)ethylamino]propan-2-ol |
| SMILES | Cn1cnc(CCNCC(O)COc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N3O2/c1-20-8-12(19-10-20)4-5-18-7-13(21)9-22-15-3-2-11(16)6-14(15)17/h2-3,6,8,10,13,18,21H,4-5,7,9H2,1H3 |
| InChIKey | QJTFNIZWEGQZDD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|