C15H16Cl2N2O2 — CID 60633675
1-(2,5-dichlorophenoxy)-3-(pyridin-4-ylmethylamino)propan-2-ol (PubChem CID 60633675) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 1-(2,5-dichlorophenoxy)-3-(pyridin-4-ylmethylamino)propan-2-ol.
| Compound Name | 1-(2,5-dichlorophenoxy)-3-(pyridin-4-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 60633675 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-(2,5-dichlorophenoxy)-3-(pyridin-4-ylmethylamino)propan-2-ol |
| SMILES | OC(CNCc1ccncc1)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O2/c16-12-1-2-14(17)15(7-12)21-10-13(20)9-19-8-11-3-5-18-6-4-11/h1-7,13,19-20H,8-10H2 |
| InChIKey | RQLFXTUMPSUYJT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |