C13H18Cl2N2O3 — CID 60909766
2-[[3-(2,5-dichlorophenoxy)-2-hydroxypropyl]amino]-N-ethylacetamide (PubChem CID 60909766) has the molecular formula C13H18Cl2N2O3 and a molecular weight of 321.20 g/mol. Its IUPAC name is 2-[[3-(2,5-dichlorophenoxy)-2-hydroxypropyl]amino]-N-ethylacetamide.
| Compound Name | 2-[[3-(2,5-dichlorophenoxy)-2-hydroxypropyl]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 60909766 |
| Molecular Formula | C13H18Cl2N2O3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[[3-(2,5-dichlorophenoxy)-2-hydroxypropyl]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNCC(O)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O3/c1-2-17-13(19)7-16-6-10(18)8-20-12-5-9(14)3-4-11(12)15/h3-5,10,16,18H,2,6-8H2,1H3,(H,17,19) |
| InChIKey | OCGQLUZHFCYIRM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |