C15H23Cl2NO2 — CID 115609657
1-(2,5-dichlorophenoxy)-3-(2-methylpentan-2-ylamino)propan-2-ol (PubChem CID 115609657) has the molecular formula C15H23Cl2NO2 and a molecular weight of 320.26 g/mol. Its IUPAC name is 1-(2,5-dichlorophenoxy)-3-(2-methylpentan-2-ylamino)propan-2-ol.
| Compound Name | 1-(2,5-dichlorophenoxy)-3-(2-methylpentan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 115609657 |
| Molecular Formula | C15H23Cl2NO2 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-(2,5-dichlorophenoxy)-3-(2-methylpentan-2-ylamino)propan-2-ol |
| SMILES | CCCC(C)(C)NCC(O)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H23Cl2NO2/c1-4-7-15(2,3)18-9-12(19)10-20-14-8-11(16)5-6-13(14)17/h5-6,8,12,18-19H,4,7,9-10H2,1-3H3 |
| InChIKey | ZXUSKZREPGPOHX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |